Products 1340319-61-0

CAS 1340319-61-0 is the registry number for 2-{4-((1-Methoxypropan-2-yl)sulfanyl)phenyl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[4-(1-methoxypropan-2-ylsulfanyl)phenyl]acetic acid (CAS 1340319-61-0) is a chemical compound with the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. IUPAC name: 2-[4-(1-methoxypropan-2-ylsulfanyl)phenyl]acetic acid. InChIKey: OSLCEOBVYLLGSF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3S
Molecular weight240.32 g/mol
IUPAC name2-[4-(1-methoxypropan-2-ylsulfanyl)phenyl]acetic acid
InChIKeyOSLCEOBVYLLGSF-UHFFFAOYSA-N
SMILESCC(COC)SC1=CC=C(C=C1)CC(=O)O

Computed by PubChem (NCBI)