Products 1329611-00-8
CAS 1329611-00-8 is the registry number for Ropinirole-d3 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1 mg.
4-[2-[propyl(3,3,3-trideuteriopropyl)amino]ethyl]-1,3-dihydroindol-2-one;hydrochloride (CAS 1329611-00-8) is a chemical compound with the molecular formula C16H25ClN2O and a molecular weight of 299.85 g/mol. IUPAC name: 4-[2-[propyl(3,3,3-trideuteriopropyl)amino]ethyl]-1,3-dihydroindol-2-one;hydrochloride. InChIKey: XDXHAEQXIBQUEZ-NIIDSAIPSA-N.
| Molecular formula | C16H25ClN2O |
|---|---|
| Molecular weight | 299.85 g/mol |
| IUPAC name | 4-[2-[propyl(3,3,3-trideuteriopropyl)amino]ethyl]-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | XDXHAEQXIBQUEZ-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])CCN(CCC)CCC1=C2CC(=O)NC2=CC=C1.Cl |
Computed by PubChem (NCBI)