Products 1329809-21-3
CAS 1329809-21-3 appears in our catalog under these names: rac Guaifenesin-d5 Cyclic Carbonate, Guaifenesin cyclic carbonate-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4,4,5-trideuterio-5-[dideuterio-(2-methoxyphenoxy)methyl]-1,3-dioxolan-2-one (CAS 1329809-21-3) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 229.24 g/mol. IUPAC name: 4,4,5-trideuterio-5-[dideuterio-(2-methoxyphenoxy)methyl]-1,3-dioxolan-2-one. InChIKey: YZXWOTFONXXTKG-RORPNYJOSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 229.24 g/mol |
| IUPAC name | 4,4,5-trideuterio-5-[dideuterio-(2-methoxyphenoxy)methyl]-1,3-dioxolan-2-one |
| InChIKey | YZXWOTFONXXTKG-RORPNYJOSA-N |
| SMILES | [2H]C1(C(OC(=O)O1)([2H])C([2H])([2H])OC2=CC=CC=C2OC)[2H] |
Computed by PubChem (NCBI)