CAS 1329833-74-0 is the registry number for 2-Chloro-5,6-dimethyl-4-methoxy Nicotinic Acid Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
Methyl 2-chloro-4-methoxy-5,6-dimethylpyridine-3-carboxylate (CAS 1329833-74-0) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: methyl 2-chloro-4-methoxy-5,6-dimethylpyridine-3-carboxylate. InChIKey: DKEGJYCVRWYPGT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | methyl 2-chloro-4-methoxy-5,6-dimethylpyridine-3-carboxylate |
| InChIKey | DKEGJYCVRWYPGT-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=C1OC)C(=O)OC)Cl)C |
Computed by PubChem (NCBI)