CAS 1329838-03-0 is the registry number for Heptobarbital-d3. Offered by: TRC. Available pack sizes: 25mg.
5-phenyl-5-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione (CAS 1329838-03-0) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 221.23 g/mol. IUPAC name: 5-phenyl-5-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione. InChIKey: LSAOZCAKUIANSQ-FIBGUPNXSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 5-phenyl-5-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | LSAOZCAKUIANSQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1(C(=O)NC(=O)NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)