Products 1330180-05-6
CAS 1330180-05-6 appears in our catalog under these names: Pethidine-d5 Hydrochloride, Meperidine-d5 hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 1mg, 0,5mg.
Ethyl 1-methyl-4-(2,3,4,5,6-pentadeuteriophenyl)piperidine-4-carboxylate;hydrochloride (CAS 1330180-05-6) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 288.82 g/mol. IUPAC name: ethyl 1-methyl-4-(2,3,4,5,6-pentadeuteriophenyl)piperidine-4-carboxylate;hydrochloride. InChIKey: WCNLCIJMFAJCPX-REAAFBMTSA-N.
| Molecular formula | C15H22ClNO2 |
|---|---|
| Molecular weight | 288.82 g/mol |
| IUPAC name | ethyl 1-methyl-4-(2,3,4,5,6-pentadeuteriophenyl)piperidine-4-carboxylate;hydrochloride |
| InChIKey | WCNLCIJMFAJCPX-REAAFBMTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(CCN(CC2)C)C(=O)OCC)[2H])[2H].Cl |
Computed by PubChem (NCBI)