CAS 1330189-10-0 appears in our catalog under these names: 2-Benzyloxy-benzoic Acid-13C3 Benzyl Ester, 2-Benzyloxy-benzoic Acid Benzyl Ester-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
Benzyl 6-phenylmethoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (CAS 1330189-10-0) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 324.32 g/mol. IUPAC name: benzyl 6-phenylmethoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate. InChIKey: HYIPKILWQXALOW-MGFYRVBCSA-N.
| Molecular formula | C21H18O3 |
|---|---|
| Molecular weight | 324.32 g/mol |
| IUPAC name | benzyl 6-phenylmethoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| InChIKey | HYIPKILWQXALOW-MGFYRVBCSA-N |
| SMILES | C1=CC=C(C=C1)CO[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)