CAS 1330277-60-5 is the registry number for N-(2-Hydroxyethyl) Pseudoephedrine-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(1R,2S)-2-[2-hydroxyethyl(trideuteriomethyl)amino]-1-phenylpropan-1-ol (CAS 1330277-60-5) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 212.30 g/mol. IUPAC name: (1R,2S)-2-[2-hydroxyethyl(trideuteriomethyl)amino]-1-phenylpropan-1-ol. InChIKey: DZUDAROQGILUTD-CBBHXFRQSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 212.30 g/mol |
| IUPAC name | (1R,2S)-2-[2-hydroxyethyl(trideuteriomethyl)amino]-1-phenylpropan-1-ol |
| InChIKey | DZUDAROQGILUTD-CBBHXFRQSA-N |
| SMILES | [2H]C([2H])([2H])N(CCO)[C@@H](C)[C@@H](C1=CC=CC=C1)O |
Computed by PubChem (NCBI)