CAS 54275-43-3 is the registry number for N-(2-Hydroxyethyl) Pseudoephedrine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg.
(1S,2S)-2-[2-hydroxyethyl(methyl)amino]-1-phenylpropan-1-ol (CAS 54275-43-3) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: (1S,2S)-2-[2-hydroxyethyl(methyl)amino]-1-phenylpropan-1-ol. InChIKey: DZUDAROQGILUTD-CMPLNLGQSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | (1S,2S)-2-[2-hydroxyethyl(methyl)amino]-1-phenylpropan-1-ol |
| InChIKey | DZUDAROQGILUTD-CMPLNLGQSA-N |
| SMILES | C[C@@H]([C@H](C1=CC=CC=C1)O)N(C)CCO |
Computed by PubChem (NCBI)