CAS 133069-19-9 is the registry number for Poly(2,5-bisoctyloxy)-1,4-phenylenevinylene). Offered by: Lumtec. Available pack sizes: On request.
6-methyl-4-phenyl-3-[(E)-2-phenylethenyl]-[1,2]oxazolo[3,4-d]pyridazin-7-one (CAS 133069-19-9) is a chemical compound with the molecular formula C20H15N3O2 and a molecular weight of 329.4 g/mol. IUPAC name: 6-methyl-4-phenyl-3-[(E)-2-phenylethenyl]-[1,2]oxazolo[3,4-d]pyridazin-7-one. InChIKey: UVZGFJXGOWUHIC-OUKQBFOZSA-N.
| Molecular formula | C20H15N3O2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 6-methyl-4-phenyl-3-[(E)-2-phenylethenyl]-[1,2]oxazolo[3,4-d]pyridazin-7-one |
| InChIKey | UVZGFJXGOWUHIC-OUKQBFOZSA-N |
| SMILES | CN1C(=O)C2=NOC(=C2C(=N1)C3=CC=CC=C3)/C=C/C4=CC=CC=C4 |
Computed by PubChem (NCBI)