CAS 749218-99-3 is the registry number for 3-Methyl-1,6-diphenyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-methyl-1,6-diphenylpyrazolo[5,4-b]pyridine-4-carboxylic acid (CAS 749218-99-3) is a chemical compound with the molecular formula C20H15N3O2 and a molecular weight of 329.4 g/mol. IUPAC name: 3-methyl-1,6-diphenylpyrazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: RNBNZWAFCTWSHQ-UHFFFAOYSA-N.
| Molecular formula | C20H15N3O2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 3-methyl-1,6-diphenylpyrazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | RNBNZWAFCTWSHQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3=CC=CC=C3)C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)