CAS 3029584-84-4 is the registry number for BSc5367, 98.21%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 10 mg, 5 mg, 25 mg, 50 mg, 100 mg.
Methyl 3-(3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)benzoate (CAS 3029584-84-4) is a chemical compound with the molecular formula C20H15N3O2 and a molecular weight of 329.4 g/mol. IUPAC name: methyl 3-(3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)benzoate. InChIKey: GZHRICWZECSYJT-UHFFFAOYSA-N.
| Molecular formula | C20H15N3O2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | methyl 3-(3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)benzoate |
| InChIKey | GZHRICWZECSYJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC3=C(NC=C3C4=CN=CC=C4)N=C2 |
Computed by PubChem (NCBI)