Products 946386-95-4
CAS 946386-95-4 is the registry number for (5-methyl-3-phenylisoxazol-4-yl)-N-(8-quinolyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
5-methyl-3-phenyl-N-quinolin-8-yl-1,2-oxazole-4-carboxamide (CAS 946386-95-4) is a chemical compound with the molecular formula C20H15N3O2 and a molecular weight of 329.4 g/mol. IUPAC name: 5-methyl-3-phenyl-N-quinolin-8-yl-1,2-oxazole-4-carboxamide. InChIKey: AHLJNJRWGRXEIR-UHFFFAOYSA-N.
| Molecular formula | C20H15N3O2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 5-methyl-3-phenyl-N-quinolin-8-yl-1,2-oxazole-4-carboxamide |
| InChIKey | AHLJNJRWGRXEIR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3=CC=CC4=C3N=CC=C4 |
Computed by PubChem (NCBI)