Products 1330751-23-9
CAS 1330751-23-9 is the registry number for 4-(Pyrrolidine-1-sulfonyl)benzene-1,2-diamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-pyrrolidin-1-ylsulfonylbenzene-1,2-diamine (CAS 1330751-23-9) is a chemical compound with the molecular formula C10H15N3O2S and a molecular weight of 241.31 g/mol. IUPAC name: 4-pyrrolidin-1-ylsulfonylbenzene-1,2-diamine. InChIKey: BBBGYVTWCHIVCH-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylsulfonylbenzene-1,2-diamine |
| InChIKey | BBBGYVTWCHIVCH-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)