Products 133156-42-0

CAS 133156-42-0 is the registry number for DMBP, 99.78%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

Methyl 2,4-dihydroxy-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate (CAS 133156-42-0) is a chemical compound with the molecular formula C21H24O4 and a molecular weight of 340.4 g/mol. IUPAC name: methyl 2,4-dihydroxy-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate. InChIKey: LYKKPZPBEBHSMF-UHFFFAOYSA-N.

Identity
Molecular formulaC21H24O4
Molecular weight340.4 g/mol
IUPAC namemethyl 2,4-dihydroxy-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate
InChIKeyLYKKPZPBEBHSMF-UHFFFAOYSA-N
SMILESCC(=CCC1=C(C=C(C(=C1O)C(=O)OC)CCC2=CC=CC=C2)O)C

Computed by PubChem (NCBI)