CAS 13317-12-9 is the registry number for 1,7-Dimethyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1,7-dimethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid (CAS 13317-12-9) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 1,7-dimethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid. InChIKey: FIQGPIHRUIEFQF-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 1,7-dimethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| InChIKey | FIQGPIHRUIEFQF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=O)C(=CN2C)C(=O)O |
Computed by PubChem (NCBI)