Products 133180-93-5
CAS 133180-93-5 appears in our catalog under these names: 1,4-Cubanebis(dimethylamide), 95%, 1,4-Cubanebis(dimethylamide). Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 25mg.
1-N,1-N,4-N,4-N-tetramethylcubane-1,4-dicarboxamide (CAS 133180-93-5) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: 1-N,1-N,4-N,4-N-tetramethylcubane-1,4-dicarboxamide. InChIKey: XQTVWELQOVLKQS-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 1-N,1-N,4-N,4-N-tetramethylcubane-1,4-dicarboxamide |
| InChIKey | XQTVWELQOVLKQS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C12C3C4C1C5C2C3C45C(=O)N(C)C |
Computed by PubChem (NCBI)