Products 1331906-27-4
CAS 1331906-27-4 appears in our catalog under these names: S-Phenylmercapturic Acid-d5, >95% (HPLC), L–Phenylmercapturic acid–d5, L-Phenylmercapturic acid-d5, 99.12%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 1 mg.
(2S)-2-acetamido-3-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpropanoic acid (CAS 1331906-27-4) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 244.32 g/mol. IUPAC name: (2S)-2-acetamido-3-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpropanoic acid. InChIKey: CICOZWHZVMOPJS-WYDCHYGLSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 244.32 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpropanoic acid |
| InChIKey | CICOZWHZVMOPJS-WYDCHYGLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])SC[C@H](C(=O)O)NC(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)