Products 2519846-58-1
CAS 2519846-58-1 is the registry number for S-Phenylmercapturic acid-d5. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2R)-2-acetamido-3-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpropanoic acid (CAS 2519846-58-1) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 244.32 g/mol. IUPAC name: (2R)-2-acetamido-3-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpropanoic acid. InChIKey: CICOZWHZVMOPJS-ZYMAPILLSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 244.32 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpropanoic acid |
| InChIKey | CICOZWHZVMOPJS-ZYMAPILLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])SC[C@@H](C(=O)O)NC(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)