CAS 1332530-23-0 is the registry number for 3-Amino-4H-pyrido(1,2-a)pyrimidin-4-one dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-aminopyrido[1,2-a]pyrimidin-4-one;dihydrochloride (CAS 1332530-23-0) is a chemical compound with the molecular formula C8H9Cl2N3O and a molecular weight of 234.08 g/mol. IUPAC name: 3-aminopyrido[1,2-a]pyrimidin-4-one;dihydrochloride. InChIKey: GJTWENJMACDCTB-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3O |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 3-aminopyrido[1,2-a]pyrimidin-4-one;dihydrochloride |
| InChIKey | GJTWENJMACDCTB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=O)N2C=C1)N.Cl.Cl |
Computed by PubChem (NCBI)