CAS 7035-79-2 is the registry number for 4-Guanidinobenzoyl chloride hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(diaminomethylideneamino)benzoyl chloride;hydrochloride (CAS 7035-79-2) is a chemical compound with the molecular formula C8H9Cl2N3O and a molecular weight of 234.08 g/mol. IUPAC name: 4-(diaminomethylideneamino)benzoyl chloride;hydrochloride. InChIKey: JBSRWFDTGDGNLG-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3O |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 4-(diaminomethylideneamino)benzoyl chloride;hydrochloride |
| InChIKey | JBSRWFDTGDGNLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)N=C(N)N.Cl |
Computed by PubChem (NCBI)