CAS 923288-59-9 is the registry number for Opicapone Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichloro-N'-hydroxy-4,6-dimethylpyridine-3-carboximidamide (CAS 923288-59-9) is a chemical compound with the molecular formula C8H9Cl2N3O and a molecular weight of 234.08 g/mol. IUPAC name: 2,5-dichloro-N'-hydroxy-4,6-dimethylpyridine-3-carboximidamide. InChIKey: WRFGQLDAKOYZHS-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3O |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2,5-dichloro-N'-hydroxy-4,6-dimethylpyridine-3-carboximidamide |
| InChIKey | WRFGQLDAKOYZHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Cl)C)Cl)/C(=N/O)/N |
Computed by PubChem (NCBI)