CAS 2172065-77-7 is the registry number for 6-amino-3,4-dihydroquinazolin-4-one dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
6-amino-3H-quinazolin-4-one;dihydrochloride (CAS 2172065-77-7) is a chemical compound with the molecular formula C8H9Cl2N3O and a molecular weight of 234.08 g/mol. IUPAC name: 6-amino-3H-quinazolin-4-one;dihydrochloride. InChIKey: VWQOHRYBPMWJAE-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2N3O |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 6-amino-3H-quinazolin-4-one;dihydrochloride |
| InChIKey | VWQOHRYBPMWJAE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)NC=N2.Cl.Cl |
Computed by PubChem (NCBI)