CAS 1704067-12-8 is the registry number for (4–Fluoro–3–((2,2,2–trifluoroethoxy)methyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-fluoro-3-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (CAS 1704067-12-8) is a chemical compound with the molecular formula C9H9BF4O3 and a molecular weight of 251.97 g/mol. IUPAC name: [4-fluoro-3-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid. InChIKey: XAIOIXMVFZMRPD-UHFFFAOYSA-N.
| Molecular formula | C9H9BF4O3 |
|---|---|
| Molecular weight | 251.97 g/mol |
| IUPAC name | [4-fluoro-3-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid |
| InChIKey | XAIOIXMVFZMRPD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)COCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)