CAS 1704066-83-0 is the registry number for 3–Fluoro–5–((2,2,2–trifluoroethoxy)methyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3-fluoro-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (CAS 1704066-83-0) is a chemical compound with the molecular formula C9H9BF4O3 and a molecular weight of 251.97 g/mol. IUPAC name: [3-fluoro-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid. InChIKey: WTOJFSPIBYRSHT-UHFFFAOYSA-N.
| Molecular formula | C9H9BF4O3 |
|---|---|
| Molecular weight | 251.97 g/mol |
| IUPAC name | [3-fluoro-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid |
| InChIKey | WTOJFSPIBYRSHT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)COCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)