Products 1332862-57-3
CAS 1332862-57-3 is the registry number for 2-Chloro-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone (CAS 1332862-57-3) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-chloro-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone. InChIKey: YTDIMCUMRKZDGU-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-chloro-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone |
| InChIKey | YTDIMCUMRKZDGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CCl)CO)O |
Computed by PubChem (NCBI)