Products 1332869-11-0

CAS 1332869-11-0 is the registry number for Baclofen Isopropyl Ester Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 4-amino-3-(4-chlorophenyl)butanoate;hydrochloride (CAS 1332869-11-0) is a chemical compound with the molecular formula C13H19Cl2NO2 and a molecular weight of 292.20 g/mol. IUPAC name: propan-2-yl 4-amino-3-(4-chlorophenyl)butanoate;hydrochloride. InChIKey: OHSLFOHXWQNNOL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19Cl2NO2
Molecular weight292.20 g/mol
IUPAC namepropan-2-yl 4-amino-3-(4-chlorophenyl)butanoate;hydrochloride
InChIKeyOHSLFOHXWQNNOL-UHFFFAOYSA-N
SMILESCC(C)OC(=O)CC(CN)C1=CC=C(C=C1)Cl.Cl

Computed by PubChem (NCBI)