CAS 1332869-11-0 is the registry number for Baclofen Isopropyl Ester Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
Propan-2-yl 4-amino-3-(4-chlorophenyl)butanoate;hydrochloride (CAS 1332869-11-0) is a chemical compound with the molecular formula C13H19Cl2NO2 and a molecular weight of 292.20 g/mol. IUPAC name: propan-2-yl 4-amino-3-(4-chlorophenyl)butanoate;hydrochloride. InChIKey: OHSLFOHXWQNNOL-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2NO2 |
|---|---|
| Molecular weight | 292.20 g/mol |
| IUPAC name | propan-2-yl 4-amino-3-(4-chlorophenyl)butanoate;hydrochloride |
| InChIKey | OHSLFOHXWQNNOL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CC(CN)C1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)