Products 1332966-00-3
CAS 1332966-00-3 appears in our catalog under these names: Mono-(4-methyl-7-oxooctyl)phthalate-d4, >95% (HPLC), 2-(((4-Methyl-7-oxooctyl)oxy)carbonyl)benzoic acid-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2,3,4,5-tetradeuterio-6-(4-methyl-7-oxooctoxy)carbonylbenzoic acid (CAS 1332966-00-3) is a chemical compound with the molecular formula C17H22O5 and a molecular weight of 310.38 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(4-methyl-7-oxooctoxy)carbonylbenzoic acid. InChIKey: UFUNVAIKYOYYBB-KNIGXJNHSA-N.
| Molecular formula | C17H22O5 |
|---|---|
| Molecular weight | 310.38 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(4-methyl-7-oxooctoxy)carbonylbenzoic acid |
| InChIKey | UFUNVAIKYOYYBB-KNIGXJNHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCC(C)CCC(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)