CAS 54166-15-3 appears in our catalog under these names: Diethyl 3–(benzyloxy)cyclobutane–1,1–dicarboxylate, Diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate, 95%, Diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate, 97%, Diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate, 98%, Diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate, 96%, 96%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 10g, 50g.
Diethyl 3-phenylmethoxycyclobutane-1,1-dicarboxylate (CAS 54166-15-3) is a chemical compound with the molecular formula C17H22O5 and a molecular weight of 306.4 g/mol. IUPAC name: diethyl 3-phenylmethoxycyclobutane-1,1-dicarboxylate. InChIKey: OSQKNXLJUGYQHW-UHFFFAOYSA-N.
| Molecular formula | C17H22O5 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | diethyl 3-phenylmethoxycyclobutane-1,1-dicarboxylate |
| InChIKey | OSQKNXLJUGYQHW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC(C1)OCC2=CC=CC=C2)C(=O)OCC |
Computed by PubChem (NCBI)