Products 153483-31-9
CAS 153483-31-9 is the registry number for Xanthinin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 5 mg, 10 mg, 1 mg.
[1-(7-methyl-3-methylidene-2-oxo-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-6-yl)-3-oxobutyl] acetate (CAS 153483-31-9) is a chemical compound with the molecular formula C17H22O5 and a molecular weight of 306.4 g/mol. IUPAC name: [1-(7-methyl-3-methylidene-2-oxo-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-6-yl)-3-oxobutyl] acetate. InChIKey: DPSCQKGSAHTWSP-UHFFFAOYSA-N.
| Molecular formula | C17H22O5 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | [1-(7-methyl-3-methylidene-2-oxo-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-6-yl)-3-oxobutyl] acetate |
| InChIKey | DPSCQKGSAHTWSP-UHFFFAOYSA-N |
| SMILES | CC1CC2C(CC=C1C(CC(=O)C)OC(=O)C)C(=C)C(=O)O2 |
Computed by PubChem (NCBI)