Products 91652-00-5

CAS 91652-00-5 appears in our catalog under these names: 4-((6-(Methacryloyloxy)hexyl)oxy)benzoic acid 95%, 4-[[6-[(2-Methyl-1-oxo-2-propen-1-yl)oxy]hexyl]oxy]benzoic acid, 95%, 95%, 4-((6-[(2-METHYLPROP-2-ENOYL)OXY]HEXYL)OXY)BENZOIC ACID, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid (CAS 91652-00-5) is a chemical compound with the molecular formula C17H22O5 and a molecular weight of 306.4 g/mol. IUPAC name: 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid. InChIKey: KAGIRXVDTGQWKF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22O5
Molecular weight306.4 g/mol
IUPAC name4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid
InChIKeyKAGIRXVDTGQWKF-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OCCCCCCOC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)