CAS 1333880-60-6 appears in our catalog under these names: T-Boc-n-amido-peg3-propargyl, 95%, Boc–NH–PEG3–propargyl, Boc-NH-PEG3-propargyl 95%, 5,8,11-Trioxa-2-azatetradec-13-ynoic acid, 1,1-dimethylethyl ester, 98%, 98%, Boc-NH-PEG3-propargyl, 97.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g, 50g, 100 mg.
Tert-butyl N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]carbamate (CAS 1333880-60-6) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: tert-butyl N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]carbamate. InChIKey: IKRULGOPBBCYPJ-UHFFFAOYSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | tert-butyl N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]carbamate |
| InChIKey | IKRULGOPBBCYPJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCC#C |
Computed by PubChem (NCBI)