CAS 13341-40-7 appears in our catalog under these names: (E)-1,2-Di(pyridin-2-yl)ethene, >98.0%(GC)(T), 2-[(E)-2-pyridin-2-ylethenyl]pyridine, 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 1g, 5g.
2-[(E)-2-pyridin-2-ylethenyl]pyridine (CAS 13341-40-7) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 2-[(E)-2-pyridin-2-ylethenyl]pyridine. InChIKey: HKEOCEQLCZEBMK-BQYQJAHWSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-[(E)-2-pyridin-2-ylethenyl]pyridine |
| InChIKey | HKEOCEQLCZEBMK-BQYQJAHWSA-N |
| SMILES | C1=CC=NC(=C1)/C=C/C2=CC=CC=N2 |
Computed by PubChem (NCBI)