Products 1334145-96-8
CAS 1334145-96-8 appears in our catalog under these names: 3,3-Dimethyl-6-phenylpiperazine-2,5-dione, 98%, 3,3-Dimethyl-6-phenylpiperazine-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3,3-dimethyl-6-phenylpiperazine-2,5-dione (CAS 1334145-96-8) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 3,3-dimethyl-6-phenylpiperazine-2,5-dione. InChIKey: SRAOVZJNDPAQAN-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 3,3-dimethyl-6-phenylpiperazine-2,5-dione |
| InChIKey | SRAOVZJNDPAQAN-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(C(=O)N1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)