Products 1334148-99-0
CAS 1334148-99-0 is the registry number for 5-Phenyl-4,5,6,7-tetrahydro-2h-indazol-3-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-phenyl-1,2,4,5,6,7-hexahydroindazol-3-one (CAS 1334148-99-0) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 5-phenyl-1,2,4,5,6,7-hexahydroindazol-3-one. InChIKey: YICCKRIEQALKQJ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 5-phenyl-1,2,4,5,6,7-hexahydroindazol-3-one |
| InChIKey | YICCKRIEQALKQJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C3=CC=CC=C3)C(=O)NN2 |
Computed by PubChem (NCBI)