Products 1334173-43-1
CAS 1334173-43-1 appears in our catalog under these names: 2-fluoro-5-[(4-methylpiperazin-1-yl)methyl]phenylboronic acid, 95%, (2-fluoro-5-((4-methylpiperazin-1-yl)methyl)phenyl)boronic acid, 95+%, (2–fluoro–5–((4–methylpiperazin–1–yl)methyl)phenyl)boronic acid, (2-fluoro-5-((4-methylpiperazin-1-yl)methyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
[2-fluoro-5-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid (CAS 1334173-43-1) is a chemical compound with the molecular formula C12H18BFN2O2 and a molecular weight of 252.10 g/mol. IUPAC name: [2-fluoro-5-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid. InChIKey: DPEWPPGDRUSVNN-UHFFFAOYSA-N.
| Molecular formula | C12H18BFN2O2 |
|---|---|
| Molecular weight | 252.10 g/mol |
| IUPAC name | [2-fluoro-5-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | DPEWPPGDRUSVNN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CN2CCN(CC2)C)F)(O)O |
Computed by PubChem (NCBI)