CAS 1704063-92-2 appears in our catalog under these names: {4-Fluoro-3-[(4-methylpiperazin-1-yl)methyl]phenyl}boronic acid, 95%, 4–Fluoro–3–((4–methylpiperazin–1–yl)methyl)phenylboronic acid, (4-fluoro-3-((4-methylpiperazin-1-yl)methyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
[4-fluoro-3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid (CAS 1704063-92-2) is a chemical compound with the molecular formula C12H18BFN2O2 and a molecular weight of 252.10 g/mol. IUPAC name: [4-fluoro-3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid. InChIKey: CTZZIMUPKCKUNQ-UHFFFAOYSA-N.
| Molecular formula | C12H18BFN2O2 |
|---|---|
| Molecular weight | 252.10 g/mol |
| IUPAC name | [4-fluoro-3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | CTZZIMUPKCKUNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)CN2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)