CAS 2377607-05-9 is the registry number for 5-Fluoro-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine (CAS 2377607-05-9) is a chemical compound with the molecular formula C12H18BFN2O2 and a molecular weight of 252.10 g/mol. IUPAC name: 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine. InChIKey: CFNYVJCIKPXDNO-UHFFFAOYSA-N.
| Molecular formula | C12H18BFN2O2 |
|---|---|
| Molecular weight | 252.10 g/mol |
| IUPAC name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine |
| InChIKey | CFNYVJCIKPXDNO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2N)N)F |
Computed by PubChem (NCBI)