CAS 1334401-01-2 is the registry number for 3–Fluoro–4–((4–methylpiperazin–1–yl)methyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid (CAS 1334401-01-2) is a chemical compound with the molecular formula C12H18BFN2O2 and a molecular weight of 252.10 g/mol. IUPAC name: [3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid. InChIKey: HITTZMNYLRWKIZ-UHFFFAOYSA-N.
| Molecular formula | C12H18BFN2O2 |
|---|---|
| Molecular weight | 252.10 g/mol |
| IUPAC name | [3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | HITTZMNYLRWKIZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN2CCN(CC2)C)F)(O)O |
Computed by PubChem (NCBI)