CAS 1334528-90-3 is the registry number for 3-(3,4-Difluorophenyl)prop-2-enal. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-3-(3,4-difluorophenyl)prop-2-enal (CAS 1334528-90-3) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: (E)-3-(3,4-difluorophenyl)prop-2-enal. InChIKey: UXOVXJKIOBNVRA-OWOJBTEDSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | (E)-3-(3,4-difluorophenyl)prop-2-enal |
| InChIKey | UXOVXJKIOBNVRA-OWOJBTEDSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C=O)F)F |
Computed by PubChem (NCBI)