CAS 1334784-87-0 is the registry number for Methyl 2-(2-methyl-3aH-imidazo[4,5-d]thiazol-5-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2-methyl-3aH-imidazo[4,5-d][1,3]thiazol-5-yl)acetate (CAS 1334784-87-0) is a chemical compound with the molecular formula C8H9N3O2S and a molecular weight of 211.24 g/mol. IUPAC name: methyl 2-(2-methyl-3aH-imidazo[4,5-d][1,3]thiazol-5-yl)acetate. InChIKey: SFFCUCYTHQGWTJ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | methyl 2-(2-methyl-3aH-imidazo[4,5-d][1,3]thiazol-5-yl)acetate |
| InChIKey | SFFCUCYTHQGWTJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2C(=NC(=N2)CC(=O)OC)S1 |
Computed by PubChem (NCBI)