CAS 915922-50-8 appears in our catalog under these names: 1-(Methylsulfonyl)-1h-benzimidazol-2-amine, 95%, 1-(Methylsulfonyl)-1H-benzo[d]imidazol-2-amine, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
1-methylsulfonylbenzimidazol-2-amine (CAS 915922-50-8) is a chemical compound with the molecular formula C8H9N3O2S and a molecular weight of 211.24 g/mol. IUPAC name: 1-methylsulfonylbenzimidazol-2-amine. InChIKey: RZUVPGKUELYOQW-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 1-methylsulfonylbenzimidazol-2-amine |
| InChIKey | RZUVPGKUELYOQW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1C2=CC=CC=C2N=C1N |
Computed by PubChem (NCBI)