CAS 303064-94-0 appears in our catalog under these names: 3-(1-Methylhydrazino)-1,2-benzisothiazole 1,1-dioxide, 95%, 3-(1-Methylhydrazino)-1,2-benzisothiazole 1,1-dioxide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
1-(1,1-dioxo-1,2-benzothiazol-3-yl)-1-methylhydrazine (CAS 303064-94-0) is a chemical compound with the molecular formula C8H9N3O2S and a molecular weight of 211.24 g/mol. IUPAC name: 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-1-methylhydrazine. InChIKey: RQGWZBBWDZAJAK-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-1-methylhydrazine |
| InChIKey | RQGWZBBWDZAJAK-UHFFFAOYSA-N |
| SMILES | CN(C1=NS(=O)(=O)C2=CC=CC=C21)N |
Computed by PubChem (NCBI)