CAS 674807-08-0 is the registry number for 2-(Ethylamino)-7-hydroxy[1,3]thiazolo[4,5-b]pyridin-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(ethylamino)-7-hydroxy-4H-[1,3]thiazolo[4,5-b]pyridin-5-one (CAS 674807-08-0) is a chemical compound with the molecular formula C8H9N3O2S and a molecular weight of 211.24 g/mol. IUPAC name: 2-(ethylamino)-7-hydroxy-4H-[1,3]thiazolo[4,5-b]pyridin-5-one. InChIKey: LQUYAPJYCANBOT-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 2-(ethylamino)-7-hydroxy-4H-[1,3]thiazolo[4,5-b]pyridin-5-one |
| InChIKey | LQUYAPJYCANBOT-UHFFFAOYSA-N |
| SMILES | CCNC1=NC2=C(S1)C(=CC(=O)N2)O |
Computed by PubChem (NCBI)