CAS 13350-60-2 appears in our catalog under these names: 2-Naphthalen-2-yl-propionic Acid, 2-(Naphthalen-2-yl)propanoic acid. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 1g, 100mg.
2-naphthalen-2-ylpropanoic acid (CAS 13350-60-2) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-naphthalen-2-ylpropanoic acid. InChIKey: DKVIPUUJSKIQFZ-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-naphthalen-2-ylpropanoic acid |
| InChIKey | DKVIPUUJSKIQFZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)