CAS 1335041-49-0 is the registry number for 3-(4-Aminophenyl)-N,N-dimethylbenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4-aminophenyl)-N,N-dimethylbenzamide (CAS 1335041-49-0) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 3-(4-aminophenyl)-N,N-dimethylbenzamide. InChIKey: WHDYNEJPKZVKCF-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 3-(4-aminophenyl)-N,N-dimethylbenzamide |
| InChIKey | WHDYNEJPKZVKCF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)