Products 1335041-93-4

CAS 1335041-93-4 is the registry number for 3-(Fmoc-NH)-nonanoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid (CAS 1335041-93-4) is a chemical compound with the molecular formula C24H29NO4 and a molecular weight of 395.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid. InChIKey: QUVRSYCVENJXLC-UHFFFAOYSA-N.

Identity
Molecular formulaC24H29NO4
Molecular weight395.5 g/mol
IUPAC name3-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid
InChIKeyQUVRSYCVENJXLC-UHFFFAOYSA-N
SMILESCCCCCCC(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)