CAS 212688-52-3 appears in our catalog under these names: Fmoc-9-aminononanoic acid, 98%, Fmoc-9-aminononanoic acid, Fmoc-9-Anc-OH 97%, 9-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)nonanoic acid, 97%, 97%, Fmoc-9-Aminononanoic acid, 98.15%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 0,1g, 0,25g, 0,5g, 2g, 100mg.
9-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid (CAS 212688-52-3) is a chemical compound with the molecular formula C24H29NO4 and a molecular weight of 395.5 g/mol. IUPAC name: 9-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid. InChIKey: LWISAKTUHDLUTN-UHFFFAOYSA-N.
| Molecular formula | C24H29NO4 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | 9-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid |
| InChIKey | LWISAKTUHDLUTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCCCCC(=O)O |
Computed by PubChem (NCBI)