CAS 2452407-76-8 appears in our catalog under these names: Donepezil EP Impurity C, Donepezil Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[(S)-(1-benzylpiperidin-4-yl)-hydroxymethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (CAS 2452407-76-8) is a chemical compound with the molecular formula C24H29NO4 and a molecular weight of 395.5 g/mol. IUPAC name: (2R)-2-[(S)-(1-benzylpiperidin-4-yl)-hydroxymethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one. InChIKey: QKRVJLPAJNHQKT-OFNKIYASSA-N.
| Molecular formula | C24H29NO4 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | (2R)-2-[(S)-(1-benzylpiperidin-4-yl)-hydroxymethyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | QKRVJLPAJNHQKT-OFNKIYASSA-N |
| SMILES | COC1=C(C=C2C(=C1)C[C@@H](C2=O)[C@H](C3CCN(CC3)CC4=CC=CC=C4)O)OC |
Computed by PubChem (NCBI)