Products 42922-10-1
CAS 42922-10-1 is the registry number for (R)-Septicine. Offered by: TRC. Available pack sizes: 75mg.
(8aR)-6,7-bis(3,4-dimethoxyphenyl)-1,2,3,5,8,8a-hexahydroindolizine (CAS 42922-10-1) is a chemical compound with the molecular formula C24H29NO4 and a molecular weight of 395.5 g/mol. IUPAC name: (8aR)-6,7-bis(3,4-dimethoxyphenyl)-1,2,3,5,8,8a-hexahydroindolizine. InChIKey: MXMHNOVMTJDCLE-GOSISDBHSA-N.
| Molecular formula | C24H29NO4 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | (8aR)-6,7-bis(3,4-dimethoxyphenyl)-1,2,3,5,8,8a-hexahydroindolizine |
| InChIKey | MXMHNOVMTJDCLE-GOSISDBHSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(CN3CCC[C@@H]3C2)C4=CC(=C(C=C4)OC)OC)OC |
Computed by PubChem (NCBI)